CAS 71964-75-5 is the registry number for 2-((6-Methoxy-2-naphthalenyl)carbonyl)benzoic Acid. Offered by: TRC. Available pack sizes: 1g, 250mg, 50mg.
2-(6-methoxynaphthalene-2-carbonyl)benzoic acid (CAS 71964-75-5) is a chemical compound with the molecular formula C19H14O4 and a molecular weight of 306.3 g/mol. IUPAC name: 2-(6-methoxynaphthalene-2-carbonyl)benzoic acid. InChIKey: MPMPJSOCGXBPOL-UHFFFAOYSA-N.
| Molecular formula | C19H14O4 |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | 2-(6-methoxynaphthalene-2-carbonyl)benzoic acid |
| InChIKey | MPMPJSOCGXBPOL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C(=O)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)