Products 2410538-67-7
CAS 2410538-67-7 appears in our catalog under these names: α-Glucosidase-IN-4/ 99.69% (existing batch purity), α-Glucosidase-IN-4, α-Glucosidase-IN-4, 99.05%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
(2-oxochromen-4-yl) (E)-3-(4-methylphenyl)prop-2-enoate (CAS 2410538-67-7) is a chemical compound with the molecular formula C19H14O4 and a molecular weight of 306.3 g/mol. IUPAC name: (2-oxochromen-4-yl) (E)-3-(4-methylphenyl)prop-2-enoate. InChIKey: QNSHUINNWDSBEP-ZHACJKMWSA-N.
| Molecular formula | C19H14O4 |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | (2-oxochromen-4-yl) (E)-3-(4-methylphenyl)prop-2-enoate |
| InChIKey | QNSHUINNWDSBEP-ZHACJKMWSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C/C(=O)OC2=CC(=O)OC3=CC=CC=C32 |
Computed by PubChem (NCBI)