Products 1346606-80-1
CAS 1346606-80-1 appears in our catalog under these names: 4'-Hydroxy Tamoxifen-d6 (contains up to 10% E isomer), 4'-Hydroxytamoxifen-d6 (contains up to 10% E isomer). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
4-[(Z)-1-[4-[2-[bis(trideuteriomethyl)amino]ethoxy]phenyl]-1-phenylbut-1-en-2-yl]phenol (CAS 1346606-80-1) is a chemical compound with the molecular formula C26H29NO2 and a molecular weight of 393.5 g/mol. IUPAC name: 4-[(Z)-1-[4-[2-[bis(trideuteriomethyl)amino]ethoxy]phenyl]-1-phenylbut-1-en-2-yl]phenol. InChIKey: DODQJNMQWMSYGS-JIVKCLLGSA-N.
| Molecular formula | C26H29NO2 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 4-[(Z)-1-[4-[2-[bis(trideuteriomethyl)amino]ethoxy]phenyl]-1-phenylbut-1-en-2-yl]phenol |
| InChIKey | DODQJNMQWMSYGS-JIVKCLLGSA-N |
| SMILES | [2H]C([2H])([2H])N(CCOC1=CC=C(C=C1)/C(=C(/CC)\C2=CC=C(C=C2)O)/C3=CC=CC=C3)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)