Products 5530-99-4

CAS 5530-99-4 is the registry number for Clomifene Impurity 3(Clomifene EP Impurity C). Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanone (CAS 5530-99-4) is a chemical compound with the molecular formula C26H29NO2 and a molecular weight of 387.5 g/mol. IUPAC name: 2-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanone. InChIKey: QRDUUUZNVAYWOU-UHFFFAOYSA-N.

Identity
Molecular formulaC26H29NO2
Molecular weight387.5 g/mol
IUPAC name2-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanone
InChIKeyQRDUUUZNVAYWOU-UHFFFAOYSA-N
SMILESCCN(CC)CCOC1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)C3=CC=CC=C3

Computed by PubChem (NCBI)