Products 164365-20-2
CAS 164365-20-2 appears in our catalog under these names: 4-Hydroxy Tamoxifen-d5, (Z)-4-Hydroxy Tamoxifen-d5, >95% (HPLC), (Z)–4–Hydroxy Tamoxifen–d5, (Z)-4-Hydroxy Tamoxifen-d5, 98.31%. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 25 mg, 10 mg, 5 mg, 1 mg.
4-[(Z)-3,3,4,4,4-pentadeuterio-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol (CAS 164365-20-2) is a chemical compound with the molecular formula C26H29NO2 and a molecular weight of 392.5 g/mol. IUPAC name: 4-[(Z)-3,3,4,4,4-pentadeuterio-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol. InChIKey: TXUZVZSFRXZGTL-FUYVPVGLSA-N.
| Molecular formula | C26H29NO2 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | 4-[(Z)-3,3,4,4,4-pentadeuterio-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| InChIKey | TXUZVZSFRXZGTL-FUYVPVGLSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])/C(=C(\C1=CC=C(C=C1)O)/C2=CC=C(C=C2)OCCN(C)C)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)