CAS 97151-04-7 appears in our catalog under these names: Toremifene Impurity 4, cis-beta-Hydroxy Tamoxifen. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg.
(E)-4-[4-[2-(dimethylamino)ethoxy]phenyl]-3,4-diphenylbut-3-en-1-ol (CAS 97151-04-7) is a chemical compound with the molecular formula C26H29NO2 and a molecular weight of 387.5 g/mol. IUPAC name: (E)-4-[4-[2-(dimethylamino)ethoxy]phenyl]-3,4-diphenylbut-3-en-1-ol. InChIKey: XIWBHBPMBIXYBK-OCEACIFDSA-N.
| Molecular formula | C26H29NO2 |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | (E)-4-[4-[2-(dimethylamino)ethoxy]phenyl]-3,4-diphenylbut-3-en-1-ol |
| InChIKey | XIWBHBPMBIXYBK-OCEACIFDSA-N |
| SMILES | CN(C)CCOC1=CC=C(C=C1)/C(=C(\CCO)/C2=CC=CC=C2)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)