CAS 1346617-48-8 is the registry number for (R)-N-Ethyl Amphetamine-d5 Hydrochloride. Offered by: TRC. Available pack sizes: 10mg, 1mg.
(2R)-N-(1,1,2,2,2-pentadeuterioethyl)-1-phenylpropan-2-amine;hydrochloride (CAS 1346617-48-8) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 204.75 g/mol. IUPAC name: (2R)-N-(1,1,2,2,2-pentadeuterioethyl)-1-phenylpropan-2-amine;hydrochloride. InChIKey: HFBTZBOJTFIRAS-BTNBZQNOSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 204.75 g/mol |
| IUPAC name | (2R)-N-(1,1,2,2,2-pentadeuterioethyl)-1-phenylpropan-2-amine;hydrochloride |
| InChIKey | HFBTZBOJTFIRAS-BTNBZQNOSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N[C@H](C)CC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)