Products 26194-77-4
CAS 26194-77-4 is the registry number for (S)-N-Ethyl Amphetamine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 2mg, 1mg, 5mg, 10mg.
(2S)-N-ethyl-1-phenylpropan-2-amine;hydrochloride (CAS 26194-77-4) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (2S)-N-ethyl-1-phenylpropan-2-amine;hydrochloride. InChIKey: HFBTZBOJTFIRAS-PPHPATTJSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (2S)-N-ethyl-1-phenylpropan-2-amine;hydrochloride |
| InChIKey | HFBTZBOJTFIRAS-PPHPATTJSA-N |
| SMILES | CCN[C@@H](C)CC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-N-Ethyl Amphetamine Hydrochloride, (S)-(+)-N-Ethylamphetamine hydrochloride, Etilamfetamine hydrochloride, (S)-, Benzeneethanamine, N-ethyl-alpha-methyl-, hydrochloride, (S)-, (+)-Ethylamphetamine hydrochlo ride, Tox21_112858, ETILAMFETAMINE HYDROCHLORIDE, (+)-, (+)-N-Ethyl-a-methyl-phenethylamine hydrochloride, (S)-N-Ethyl-a-methylbenzeneethanamine hydrochloride, (2S)-N-Ethyl-1-phenylpropan-2-amine--hydrogen chloride (1/1)