Products 1348117-98-5
CAS 1348117-98-5 appears in our catalog under these names: Ornidazole Impurity 25, Ornidazole Impurity 7, Ornidazole Impurity 11. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-chloro-2-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol (CAS 1348117-98-5) is a chemical compound with the molecular formula C7H10ClN3O3 and a molecular weight of 219.62 g/mol. IUPAC name: 3-chloro-2-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol. InChIKey: QVQPRDWUIKKAPU-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN3O3 |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 3-chloro-2-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol |
| InChIKey | QVQPRDWUIKKAPU-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1C(CO)CCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)