CAS 14419-11-5 appears in our catalog under these names: Ornidazole Impurity 6, Ornidazole Impurity H, Ornidazole Isomer (Impurity), >95% (HPLC), 1-(3-Chloro-2-hydroxypropyl)-2-methyl-4-nitroimidazole. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 2,5g, 250mg, 25mg, 100mg.
1-chloro-3-(2-methyl-4-nitroimidazol-1-yl)propan-2-ol (CAS 14419-11-5) is a chemical compound with the molecular formula C7H10ClN3O3 and a molecular weight of 219.62 g/mol. IUPAC name: 1-chloro-3-(2-methyl-4-nitroimidazol-1-yl)propan-2-ol. InChIKey: JCFLTWHMNZZBFW-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN3O3 |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 1-chloro-3-(2-methyl-4-nitroimidazol-1-yl)propan-2-ol |
| InChIKey | JCFLTWHMNZZBFW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CN1CC(CCl)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)