CAS 2142615-58-3 is the registry number for Ornidazole Impurity 51. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-chloro-3-(2-methyl-4-nitroimidazol-1-yl)propan-2-ol (CAS 2142615-58-3) is a chemical compound with the molecular formula C7H10ClN3O3 and a molecular weight of 219.62 g/mol. IUPAC name: (2S)-1-chloro-3-(2-methyl-4-nitroimidazol-1-yl)propan-2-ol. InChIKey: JCFLTWHMNZZBFW-ZCFIWIBFSA-N.
| Molecular formula | C7H10ClN3O3 |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | (2S)-1-chloro-3-(2-methyl-4-nitroimidazol-1-yl)propan-2-ol |
| InChIKey | JCFLTWHMNZZBFW-ZCFIWIBFSA-N |
| SMILES | CC1=NC(=CN1C[C@@H](CCl)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)