CAS 166734-80-1 appears in our catalog under these names: (R)-Ornidazole, Ornidazole Impurity 8（(R)-Ornidazole）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R)-1-chloro-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol (CAS 166734-80-1) is a chemical compound with the molecular formula C7H10ClN3O3 and a molecular weight of 219.62 g/mol. IUPAC name: (2R)-1-chloro-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol. InChIKey: IPWKIXLWTCNBKN-LURJTMIESA-N.
| Molecular formula | C7H10ClN3O3 |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | (2R)-1-chloro-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
| InChIKey | IPWKIXLWTCNBKN-LURJTMIESA-N |
| SMILES | CC1=NC=C(N1C[C@H](CCl)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)