CAS 134812-28-5 appears in our catalog under these names: 3-(1,3-Thiazol-4-yl)aniline, 95%, 3–(1,3–Thiazol–4–yl)aniline, 3-(Thiazol-4-yl)aniline 95%, 3-(1,3-Thiazol-4-yl)Aniline. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g, 50mg, 100mg.
3-(1,3-thiazol-4-yl)aniline (CAS 134812-28-5) is a chemical compound with the molecular formula C9H8N2S and a molecular weight of 176.24 g/mol. IUPAC name: 3-(1,3-thiazol-4-yl)aniline. InChIKey: IEKBOUQLQRHVRN-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S |
|---|---|
| Molecular weight | 176.24 g/mol |
| IUPAC name | 3-(1,3-thiazol-4-yl)aniline |
| InChIKey | IEKBOUQLQRHVRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CSC=N2 |
Computed by PubChem (NCBI)