Products 39136-63-5
CAS 39136-63-5 appears in our catalog under these names: 2–Amino–5–phenylthiazole, 5-Phenylthiazol-2-amine, 2-Amino-5-phenylthiazole, 97%, 5-Phenylthiazol-2-amine 98%, 5-Phenylthiazol-2-amine, 95%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100mg, 250mg, 500mg.
5-phenyl-1,3-thiazol-2-amine (CAS 39136-63-5) is a chemical compound with the molecular formula C9H8N2S and a molecular weight of 176.24 g/mol. IUPAC name: 5-phenyl-1,3-thiazol-2-amine. InChIKey: LSLUWQIENURREM-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S |
|---|---|
| Molecular weight | 176.24 g/mol |
| IUPAC name | 5-phenyl-1,3-thiazol-2-amine |
| InChIKey | LSLUWQIENURREM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(S2)N |
Computed by PubChem (NCBI)