CAS 184097-39-0 appears in our catalog under these names: 3-(1,3-Thiazol-2-yl)aniline, 95%, 3-(Thiazol-2-yl)aniline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 100mg, 1g.
3-(1,3-thiazol-2-yl)aniline (CAS 184097-39-0) is a chemical compound with the molecular formula C9H8N2S and a molecular weight of 176.24 g/mol. IUPAC name: 3-(1,3-thiazol-2-yl)aniline. InChIKey: JPPYODFEZAMAQD-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S |
|---|---|
| Molecular weight | 176.24 g/mol |
| IUPAC name | 3-(1,3-thiazol-2-yl)aniline |
| InChIKey | JPPYODFEZAMAQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NC=CS2 |
Computed by PubChem (NCBI)