Products 59108-90-6
CAS 59108-90-6 appears in our catalog under these names: 1H-Indole-3-carbothioic acid amide, 95%, Indole–3–thio Carboxamide, 1H-Indole-3-carbothioic acid amide, Indole-3-thio carboxamide, 98.98%, 1H-Indole-3-carbothioamide. Offered by: Combi-blocks, GLPBio, Biosynth, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 500mg, 5g, 0,5g, 50 mg, 100 mg, 250 mg.
1H-indole-3-carbothioamide (CAS 59108-90-6) is a chemical compound with the molecular formula C9H8N2S and a molecular weight of 176.24 g/mol. IUPAC name: 1H-indole-3-carbothioamide. InChIKey: PPWNZMJWESSLGE-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S |
|---|---|
| Molecular weight | 176.24 g/mol |
| IUPAC name | 1H-indole-3-carbothioamide |
| InChIKey | PPWNZMJWESSLGE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=S)N |
Computed by PubChem (NCBI)