Products 134899-86-8

CAS 134899-86-8 is the registry number for D-Serine, 2-Methyl-, Methyl ester, hydrochloride (1, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Methyl (2R)-2-amino-3-hydroxy-2-methylpropanoate;hydrochloride (CAS 134899-86-8) is a chemical compound with the molecular formula C5H12ClNO3 and a molecular weight of 169.61 g/mol. IUPAC name: methyl (2R)-2-amino-3-hydroxy-2-methylpropanoate;hydrochloride. InChIKey: OBOVZRPIWXDGEL-NUBCRITNSA-N.

Identity
Molecular formulaC5H12ClNO3
Molecular weight169.61 g/mol
IUPAC namemethyl (2R)-2-amino-3-hydroxy-2-methylpropanoate;hydrochloride
InChIKeyOBOVZRPIWXDGEL-NUBCRITNSA-N
SMILESC[C@@](CO)(C(=O)OC)N.Cl

Computed by PubChem (NCBI)