Products 13491-42-4
CAS 13491-42-4 is the registry number for N4-Methylarabinocytidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(methylamino)pyrimidin-2-one (CAS 13491-42-4) is a chemical compound with the molecular formula C10H15N3O5 and a molecular weight of 257.24 g/mol. IUPAC name: 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(methylamino)pyrimidin-2-one. InChIKey: LZCNWAXLJWBRJE-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O5 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(methylamino)pyrimidin-2-one |
| InChIKey | LZCNWAXLJWBRJE-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=O)N(C=C1)C2C(C(C(O2)CO)O)O |
Computed by PubChem (NCBI)