CAS 134937-38-5 appears in our catalog under these names: 1-(4-Methylbenzenesulfonyl)cyclopentane-1-carboxylic acid, 98%, 1-(4-Methylbenzenesulfonyl)cyclopentane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(4-methylphenyl)sulfonylcyclopentane-1-carboxylic acid (CAS 134937-38-5) is a chemical compound with the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylcyclopentane-1-carboxylic acid. InChIKey: FBXBJKJVRNXBNJ-UHFFFAOYSA-N.
| Molecular formula | C13H16O4S |
|---|---|
| Molecular weight | 268.33 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylcyclopentane-1-carboxylic acid |
| InChIKey | FBXBJKJVRNXBNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2(CCCC2)C(=O)O |
Computed by PubChem (NCBI)