CAS 2522927-67-7 is the registry number for 2-Oxaspiro[3.3]heptan-6-yl 4-methylbenzenesulfonate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-oxaspiro[3.3]heptan-6-yl 4-methylbenzenesulfonate (CAS 2522927-67-7) is a chemical compound with the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. IUPAC name: 2-oxaspiro[3.3]heptan-6-yl 4-methylbenzenesulfonate. InChIKey: RGELHMACRWELNF-UHFFFAOYSA-N.
| Molecular formula | C13H16O4S |
|---|---|
| Molecular weight | 268.33 g/mol |
| IUPAC name | 2-oxaspiro[3.3]heptan-6-yl 4-methylbenzenesulfonate |
| InChIKey | RGELHMACRWELNF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CC3(C2)COC3 |
Computed by PubChem (NCBI)