CAS 23511-04-8 is the registry number for 4-Oxocyclohexyl 4-methylbenzenesulfonate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(4-oxocyclohexyl) 4-methylbenzenesulfonate (CAS 23511-04-8) is a chemical compound with the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. IUPAC name: (4-oxocyclohexyl) 4-methylbenzenesulfonate. InChIKey: WDKMRHPBPTUYDX-UHFFFAOYSA-N.
| Molecular formula | C13H16O4S |
|---|---|
| Molecular weight | 268.33 g/mol |
| IUPAC name | (4-oxocyclohexyl) 4-methylbenzenesulfonate |
| InChIKey | WDKMRHPBPTUYDX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CCC(=O)CC2 |
Computed by PubChem (NCBI)