Products 327618-08-6

CAS 327618-08-6 is the registry number for Benzyl 2-methyltetrahydrothiophene-2-carboxylate 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Benzyl 2-methyl-1,1-dioxothiolane-2-carboxylate (CAS 327618-08-6) is a chemical compound with the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. IUPAC name: benzyl 2-methyl-1,1-dioxothiolane-2-carboxylate. InChIKey: ZDHYSYRWHCPUBM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O4S
Molecular weight268.33 g/mol
IUPAC namebenzyl 2-methyl-1,1-dioxothiolane-2-carboxylate
InChIKeyZDHYSYRWHCPUBM-UHFFFAOYSA-N
SMILESCC1(CCCS1(=O)=O)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)