CAS 134992-24-8 is the registry number for 6–Methyl–2,4–bis(methylthio)–3–nitropyridine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
6-methyl-2,4-bis(methylsulfanyl)-3-nitropyridine (CAS 134992-24-8) is a chemical compound with the molecular formula C8H10N2O2S2 and a molecular weight of 230.3 g/mol. IUPAC name: 6-methyl-2,4-bis(methylsulfanyl)-3-nitropyridine. InChIKey: VZIRTVZMIOEMFW-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2S2 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | 6-methyl-2,4-bis(methylsulfanyl)-3-nitropyridine |
| InChIKey | VZIRTVZMIOEMFW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=N1)SC)[N+](=O)[O-])SC |
Computed by PubChem (NCBI)