Products 901345-89-9
CAS 901345-89-9 is the registry number for N-(3-Cyano-4,5-dimethylthiophen-2-yl)methanesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-cyano-4,5-dimethylthiophen-2-yl)methanesulfonamide (CAS 901345-89-9) is a chemical compound with the molecular formula C8H10N2O2S2 and a molecular weight of 230.3 g/mol. IUPAC name: N-(3-cyano-4,5-dimethylthiophen-2-yl)methanesulfonamide. InChIKey: ITTCZKQDKLVVIC-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2S2 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | N-(3-cyano-4,5-dimethylthiophen-2-yl)methanesulfonamide |
| InChIKey | ITTCZKQDKLVVIC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C#N)NS(=O)(=O)C)C |
Computed by PubChem (NCBI)