CAS 72744-67-3 appears in our catalog under these names: Pidotimod Impurity B, Pidotimod Impurity 5, (5aR,10aR)-Tetrahydrodithiazolo(3,4-a:3',4'-d)pyrazine-5,10(3H,8H)-dione, >95% (HPLC), (5aR,10aR)-Tetrahydro-3H,5H,8H,10H-bisthiazolo(3,4-a:3',4'-d)pyrazine-5,10-dione. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 2mg.
(3R,9R)-5,11-dithia-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione (CAS 72744-67-3) is a chemical compound with the molecular formula C8H10N2O2S2 and a molecular weight of 230.3 g/mol. IUPAC name: (3R,9R)-5,11-dithia-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione. InChIKey: IBBKEOUUWVDDIT-WDSKDSINSA-N.
| Molecular formula | C8H10N2O2S2 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | (3R,9R)-5,11-dithia-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione |
| InChIKey | IBBKEOUUWVDDIT-WDSKDSINSA-N |
| SMILES | C1[C@H]2C(=O)N3CSC[C@H]3C(=O)N2CS1 |
Computed by PubChem (NCBI)