Products 502142-27-0

CAS 502142-27-0 is the registry number for Methyl 2,6-bis(methylsulfanyl)pyrimidine-4-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Methyl 2,6-bis(methylsulfanyl)pyrimidine-4-carboxylate (CAS 502142-27-0) is a chemical compound with the molecular formula C8H10N2O2S2 and a molecular weight of 230.3 g/mol. IUPAC name: methyl 2,6-bis(methylsulfanyl)pyrimidine-4-carboxylate. InChIKey: NVHPGEVUZLPJAG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O2S2
Molecular weight230.3 g/mol
IUPAC namemethyl 2,6-bis(methylsulfanyl)pyrimidine-4-carboxylate
InChIKeyNVHPGEVUZLPJAG-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=NC(=N1)SC)SC

Computed by PubChem (NCBI)