CAS 135-68-2 appears in our catalog under these names: 4-Amino-4'-chloro-biphenyl, 95%, 4-Amino-4'-chlorobiphenyl, 97%, 4'-Chloro-[1,1'-biphenyl]-4-amine, 98%. Offered by: Combi-blocks, Thermo Scientific (Acros), Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
4-(4-chlorophenyl)aniline (CAS 135-68-2) is a chemical compound with the molecular formula C12H10ClN and a molecular weight of 203.67 g/mol. IUPAC name: 4-(4-chlorophenyl)aniline. InChIKey: OREQWMWYRYXCDF-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 4-(4-chlorophenyl)aniline |
| InChIKey | OREQWMWYRYXCDF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)