CAS 1350760-27-8 appears in our catalog under these names: 2,6-Dimethyl-2',4'-difluorobiphenyl-4-carboxaldehyde, 95%, 2,6-Dimethyl-2',4'-difluorobiphenyl-4-carboxaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
4-(2,4-difluorophenyl)-3,5-dimethylbenzaldehyde (CAS 1350760-27-8) is a chemical compound with the molecular formula C15H12F2O and a molecular weight of 246.25 g/mol. IUPAC name: 4-(2,4-difluorophenyl)-3,5-dimethylbenzaldehyde. InChIKey: ZVQMAFXGZUNPGE-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O |
|---|---|
| Molecular weight | 246.25 g/mol |
| IUPAC name | 4-(2,4-difluorophenyl)-3,5-dimethylbenzaldehyde |
| InChIKey | ZVQMAFXGZUNPGE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C2=C(C=C(C=C2)F)F)C)C=O |
Computed by PubChem (NCBI)