CAS 2586126-65-8 is the registry number for 4-(1-(2,4-Difluorophenyl)ethyl)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-[1-(2,4-difluorophenyl)ethyl]benzaldehyde (CAS 2586126-65-8) is a chemical compound with the molecular formula C15H12F2O and a molecular weight of 246.25 g/mol. IUPAC name: 4-[1-(2,4-difluorophenyl)ethyl]benzaldehyde. InChIKey: VXEKVQHAUCCFRC-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O |
|---|---|
| Molecular weight | 246.25 g/mol |
| IUPAC name | 4-[1-(2,4-difluorophenyl)ethyl]benzaldehyde |
| InChIKey | VXEKVQHAUCCFRC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C=O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)