Products 1504609-61-3
CAS 1504609-61-3 is the registry number for 2-(3,4-Difluorophenyl)-1-(p-tolyl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3,4-difluorophenyl)-1-(4-methylphenyl)ethanone (CAS 1504609-61-3) is a chemical compound with the molecular formula C15H12F2O and a molecular weight of 246.25 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-1-(4-methylphenyl)ethanone. InChIKey: CWUPYTWOQQYKRQ-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O |
|---|---|
| Molecular weight | 246.25 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-1-(4-methylphenyl)ethanone |
| InChIKey | CWUPYTWOQQYKRQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)