Products 1432484-52-0

CAS 1432484-52-0 is the registry number for 4-Benzyloxy-1-(2,2-difluorovinyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-(2,2-difluoroethenyl)-4-phenylmethoxybenzene (CAS 1432484-52-0) is a chemical compound with the molecular formula C15H12F2O and a molecular weight of 246.25 g/mol. IUPAC name: 1-(2,2-difluoroethenyl)-4-phenylmethoxybenzene. InChIKey: QNWIOUYWQLSSJK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12F2O
Molecular weight246.25 g/mol
IUPAC name1-(2,2-difluoroethenyl)-4-phenylmethoxybenzene
InChIKeyQNWIOUYWQLSSJK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC=C(C=C2)C=C(F)F

Computed by PubChem (NCBI)