Products 1350760-65-4
CAS 1350760-65-4 is the registry number for 1,3-Dibromo-5-(bromomethyl)-2-chlorobenzene. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,3-dibromo-5-(bromomethyl)-2-chlorobenzene (CAS 1350760-65-4) is a chemical compound with the molecular formula C7H4Br3Cl and a molecular weight of 363.27 g/mol. IUPAC name: 1,3-dibromo-5-(bromomethyl)-2-chlorobenzene. InChIKey: JKJVAQQJQXBJDX-UHFFFAOYSA-N.
| Molecular formula | C7H4Br3Cl |
|---|---|
| Molecular weight | 363.27 g/mol |
| IUPAC name | 1,3-dibromo-5-(bromomethyl)-2-chlorobenzene |
| InChIKey | JKJVAQQJQXBJDX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)Cl)Br)CBr |
Computed by PubChem (NCBI)