CAS 1881329-87-8 is the registry number for 1-Bromo-3-chloro-5-(dibromomethyl)benzene, tech grade, 92%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-bromo-3-chloro-5-(dibromomethyl)benzene (CAS 1881329-87-8) is a chemical compound with the molecular formula C7H4Br3Cl and a molecular weight of 363.27 g/mol. IUPAC name: 1-bromo-3-chloro-5-(dibromomethyl)benzene. InChIKey: UPNSDOWELMBZLC-UHFFFAOYSA-N.
| Molecular formula | C7H4Br3Cl |
|---|---|
| Molecular weight | 363.27 g/mol |
| IUPAC name | 1-bromo-3-chloro-5-(dibromomethyl)benzene |
| InChIKey | UPNSDOWELMBZLC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)C(Br)Br |
Computed by PubChem (NCBI)