CAS 2918965-58-7 is the registry number for 1,3,4-tribromo-2-chloro-5-methylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3,4-tribromo-2-chloro-5-methylbenzene (CAS 2918965-58-7) is a chemical compound with the molecular formula C7H4Br3Cl and a molecular weight of 363.27 g/mol. IUPAC name: 1,3,4-tribromo-2-chloro-5-methylbenzene. InChIKey: FQJGXYUCZNMDJP-UHFFFAOYSA-N.
| Molecular formula | C7H4Br3Cl |
|---|---|
| Molecular weight | 363.27 g/mol |
| IUPAC name | 1,3,4-tribromo-2-chloro-5-methylbenzene |
| InChIKey | FQJGXYUCZNMDJP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1Br)Br)Cl)Br |
Computed by PubChem (NCBI)