CAS 2764730-51-8 is the registry number for 1,2,3-Tribromo-4-chloro-5-methylbenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1,2,3-tribromo-4-chloro-5-methylbenzene (CAS 2764730-51-8) is a chemical compound with the molecular formula C7H4Br3Cl and a molecular weight of 363.27 g/mol. IUPAC name: 1,2,3-tribromo-4-chloro-5-methylbenzene. InChIKey: ODFHXTAKHVEKIW-UHFFFAOYSA-N.
| Molecular formula | C7H4Br3Cl |
|---|---|
| Molecular weight | 363.27 g/mol |
| IUPAC name | 1,2,3-tribromo-4-chloro-5-methylbenzene |
| InChIKey | ODFHXTAKHVEKIW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1Cl)Br)Br)Br |
Computed by PubChem (NCBI)