Products 135128-60-8
CAS 135128-60-8 is the registry number for 4-(4-Ethoxyphenyl)-2-(3-methyl-5-oxo-1-phenyl(2-pyrazolin-4-yl))-4-oxobutanoic acid. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
4-(4-ethoxyphenyl)-2-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)-4-oxobutanoic acid (CAS 135128-60-8) is a chemical compound with the molecular formula C22H22N2O5 and a molecular weight of 394.4 g/mol. IUPAC name: 4-(4-ethoxyphenyl)-2-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)-4-oxobutanoic acid. InChIKey: GUZIKWYQZFZXLF-UHFFFAOYSA-N.
| Molecular formula | C22H22N2O5 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 4-(4-ethoxyphenyl)-2-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)-4-oxobutanoic acid |
| InChIKey | GUZIKWYQZFZXLF-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C(=O)CC(C2C(=NN(C2=O)C3=CC=CC=C3)C)C(=O)O |
Computed by PubChem (NCBI)