Products 2361610-55-9
CAS 2361610-55-9 is the registry number for 2-{[(2R)-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}pyrrolidin-2-yl]formamido}acetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
2-[[(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]acetic acid (CAS 2361610-55-9) is a chemical compound with the molecular formula C22H22N2O5 and a molecular weight of 394.4 g/mol. IUPAC name: 2-[[(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]acetic acid. InChIKey: YINDOSYVRZADBY-LJQANCHMSA-N.
| Molecular formula | C22H22N2O5 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 2-[[(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]acetic acid |
| InChIKey | YINDOSYVRZADBY-LJQANCHMSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)