Products 1106685-66-8
CAS 1106685-66-8 appears in our catalog under these names: 4-Hydroxy Methyl Ambrisentan, Ambrisentan Impurity 5, (S)-4-Hydroxymethyl Ambrisentan. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
(2S)-2-[4-(hydroxymethyl)-6-methylpyrimidin-2-yl]oxy-3-methoxy-3,3-diphenylpropanoic acid (CAS 1106685-66-8) is a chemical compound with the molecular formula C22H22N2O5 and a molecular weight of 394.4 g/mol. IUPAC name: (2S)-2-[4-(hydroxymethyl)-6-methylpyrimidin-2-yl]oxy-3-methoxy-3,3-diphenylpropanoic acid. InChIKey: PDUAYPFMBRYSNN-LJQANCHMSA-N.
| Molecular formula | C22H22N2O5 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | (2S)-2-[4-(hydroxymethyl)-6-methylpyrimidin-2-yl]oxy-3-methoxy-3,3-diphenylpropanoic acid |
| InChIKey | PDUAYPFMBRYSNN-LJQANCHMSA-N |
| SMILES | CC1=CC(=NC(=N1)O[C@H](C(=O)O)C(C2=CC=CC=C2)(C3=CC=CC=C3)OC)CO |
Computed by PubChem (NCBI)