CAS 250695-65-9 appears in our catalog under these names: Fmoc-pro-gly-oh, 95%, 2-{((2S)-1-{((9H-Fluoren-9-yl)methoxy)carbonyl}pyrrolidin-2-yl)formamido}acetic acid, 95%, Fmoc–Pro–Gly–OH, Fmoc-L-Pro-Gly-OH, Fmoc-Pro-Gly-OH. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 250mg, 5g, 1g, 25g, 0,25g, 0,1g, 0,5g, 2g.
2-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]acetic acid (CAS 250695-65-9) is a chemical compound with the molecular formula C22H22N2O5 and a molecular weight of 394.4 g/mol. IUPAC name: 2-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]acetic acid. InChIKey: YINDOSYVRZADBY-IBGZPJMESA-N.
| Molecular formula | C22H22N2O5 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 2-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]acetic acid |
| InChIKey | YINDOSYVRZADBY-IBGZPJMESA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)