CAS 458546-95-7 is the registry number for Fmoc-cis-4-NH(Ac)-Pro-OH 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2S,4S)-4-acetamido-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS 458546-95-7) is a chemical compound with the molecular formula C22H22N2O5 and a molecular weight of 394.4 g/mol. IUPAC name: (2S,4S)-4-acetamido-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid. InChIKey: SNZNPVJFYPDHKC-XOBRGWDASA-N.
| Molecular formula | C22H22N2O5 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | (2S,4S)-4-acetamido-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | SNZNPVJFYPDHKC-XOBRGWDASA-N |
| SMILES | CC(=O)N[C@H]1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)