CAS 1351338-15-2 is the registry number for (S)-2-(4-Hydroxyphenyl)-6-methyl-2,3-dihydro-4H-pyran-4-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-(4-hydroxyphenyl)-6-methyl-2,3-dihydropyran-4-one (CAS 1351338-15-2) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: (2S)-2-(4-hydroxyphenyl)-6-methyl-2,3-dihydropyran-4-one. InChIKey: STTXNQGVHWYOHI-LBPRGKRZSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2S)-2-(4-hydroxyphenyl)-6-methyl-2,3-dihydropyran-4-one |
| InChIKey | STTXNQGVHWYOHI-LBPRGKRZSA-N |
| SMILES | CC1=CC(=O)C[C@H](O1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)