Products 1351360-87-6
CAS 1351360-87-6 is the registry number for WAY-660313, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzene-1,2-diol (CAS 1351360-87-6) is a chemical compound with the molecular formula C14H17N3O2S and a molecular weight of 291.37 g/mol. IUPAC name: 4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzene-1,2-diol. InChIKey: RHRQDVGKYZMNJA-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O2S |
|---|---|
| Molecular weight | 291.37 g/mol |
| IUPAC name | 4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzene-1,2-diol |
| InChIKey | RHRQDVGKYZMNJA-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC(=CS2)C3=CC(=C(C=C3)O)O |
Computed by PubChem (NCBI)