Products 1351809-48-7
CAS 1351809-48-7 is the registry number for 1-(4-Aminobenzyl)-n-(3-methoxyphenyl)-1h-imidazole-4-carboxamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[(4-aminophenyl)methyl]-N-(3-methoxyphenyl)imidazole-4-carboxamide (CAS 1351809-48-7) is a chemical compound with the molecular formula C18H18N4O2 and a molecular weight of 322.4 g/mol. IUPAC name: 1-[(4-aminophenyl)methyl]-N-(3-methoxyphenyl)imidazole-4-carboxamide. InChIKey: VDFNQQXENSDXHS-UHFFFAOYSA-N.
| Molecular formula | C18H18N4O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 1-[(4-aminophenyl)methyl]-N-(3-methoxyphenyl)imidazole-4-carboxamide |
| InChIKey | VDFNQQXENSDXHS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)NC(=O)C2=CN(C=N2)CC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)