CAS 34262-84-5 appears in our catalog under these names: Mesocarb, >95% (HPLC), Mesocarb (1 mg/mL in Methanol). Offered by: TRC. Available pack sizes: 50mg, 5mg, 1x1ml.
N-phenyl-N'-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]carbamimidate (CAS 34262-84-5) is a chemical compound with the molecular formula C18H18N4O2 and a molecular weight of 322.4 g/mol. IUPAC name: N-phenyl-N'-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]carbamimidate. InChIKey: OWFUPROYPKGHMH-UHFFFAOYSA-N.
| Molecular formula | C18H18N4O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | N-phenyl-N'-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]carbamimidate |
| InChIKey | OWFUPROYPKGHMH-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=CC=C1)[N+]2=NOC(=C2)/N=C(/NC3=CC=CC=C3)\[O-] |
Computed by PubChem (NCBI)