Products 2587607-85-8
CAS 2587607-85-8 appears in our catalog under these names: Eltrombopag Impurity 53, Des benzoic Acid Eltrombopag. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
2-(3,4-dimethylphenyl)-4-[(2-hydroxyphenyl)diazenyl]-5-methyl-1H-pyrazol-3-one (CAS 2587607-85-8) is a chemical compound with the molecular formula C18H18N4O2 and a molecular weight of 322.4 g/mol. IUPAC name: 2-(3,4-dimethylphenyl)-4-[(2-hydroxyphenyl)diazenyl]-5-methyl-1H-pyrazol-3-one. InChIKey: BOJZPVAZWCZCSQ-UHFFFAOYSA-N.
| Molecular formula | C18H18N4O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 2-(3,4-dimethylphenyl)-4-[(2-hydroxyphenyl)diazenyl]-5-methyl-1H-pyrazol-3-one |
| InChIKey | BOJZPVAZWCZCSQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=O)C(=C(N2)C)N=NC3=CC=CC=C3O)C |
Computed by PubChem (NCBI)
Synonyms:
Des benzoic Acid Eltrombopag