CAS 73922-29-9 appears in our catalog under these names: I-Sydnocarb (1.0mg/ml in Acetonitrile), I-Sydnocarb. Offered by: TRC, Biosynth. Available pack sizes: 5x1ml, 25mg, 50mg, 5mg.
N-phenyl-N'-[3-[(2R)-1-phenylpropan-2-yl]oxadiazol-3-ium-5-yl]carbamimidate (CAS 73922-29-9) is a chemical compound with the molecular formula C18H18N4O2 and a molecular weight of 322.4 g/mol. IUPAC name: N-phenyl-N'-[3-[(2R)-1-phenylpropan-2-yl]oxadiazol-3-ium-5-yl]carbamimidate. InChIKey: OWFUPROYPKGHMH-CQSZACIVSA-N.
| Molecular formula | C18H18N4O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | N-phenyl-N'-[3-[(2R)-1-phenylpropan-2-yl]oxadiazol-3-ium-5-yl]carbamimidate |
| InChIKey | OWFUPROYPKGHMH-CQSZACIVSA-N |
| SMILES | C[C@H](CC1=CC=CC=C1)[N+]2=NOC(=C2)/N=C(/NC3=CC=CC=C3)\[O-] |
Computed by PubChem (NCBI)