CAS 1352216-37-5 appears in our catalog under these names: 2,2-Difluoro-1-(3-(methylthio)phenyl)ethanone, 95%, 95%, 2,2-Difluoro-1-(3-methylsulfanyl-phenyl)ethanone, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,2-difluoro-1-(3-methylsulfanylphenyl)ethanone (CAS 1352216-37-5) is a chemical compound with the molecular formula C9H8F2OS and a molecular weight of 202.22 g/mol. IUPAC name: 2,2-difluoro-1-(3-methylsulfanylphenyl)ethanone. InChIKey: PIQXZHJXNQMHFS-UHFFFAOYSA-N.
| Molecular formula | C9H8F2OS |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 2,2-difluoro-1-(3-methylsulfanylphenyl)ethanone |
| InChIKey | PIQXZHJXNQMHFS-UHFFFAOYSA-N |
| SMILES | CSC1=CC=CC(=C1)C(=O)C(F)F |
Computed by PubChem (NCBI)