CAS 1891224-30-8 is the registry number for 1-(2,4-Difluoro-3-(methylthio)phenyl)ethanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2,4-difluoro-3-methylsulfanylphenyl)ethanone (CAS 1891224-30-8) is a chemical compound with the molecular formula C9H8F2OS and a molecular weight of 202.22 g/mol. IUPAC name: 1-(2,4-difluoro-3-methylsulfanylphenyl)ethanone. InChIKey: MCBSKMZHJYVVEP-UHFFFAOYSA-N.
| Molecular formula | C9H8F2OS |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 1-(2,4-difluoro-3-methylsulfanylphenyl)ethanone |
| InChIKey | MCBSKMZHJYVVEP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)F)SC)F |
Computed by PubChem (NCBI)