CAS 473299-27-3 is the registry number for 1-(3,5-Difluoro-4-(methylthio)phenyl)ethan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3,5-difluoro-4-methylsulfanylphenyl)ethanone (CAS 473299-27-3) is a chemical compound with the molecular formula C9H8F2OS and a molecular weight of 202.22 g/mol. IUPAC name: 1-(3,5-difluoro-4-methylsulfanylphenyl)ethanone. InChIKey: DFPNTYXNRALSJP-UHFFFAOYSA-N.
| Molecular formula | C9H8F2OS |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 1-(3,5-difluoro-4-methylsulfanylphenyl)ethanone |
| InChIKey | DFPNTYXNRALSJP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)F)SC)F |
Computed by PubChem (NCBI)