Products 145326-60-9
CAS 145326-60-9 is the registry number for 1-{4-((Difluoromethyl)sulfanyl)phenyl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[4-(difluoromethylsulfanyl)phenyl]ethanone (CAS 145326-60-9) is a chemical compound with the molecular formula C9H8F2OS and a molecular weight of 202.22 g/mol. IUPAC name: 1-[4-(difluoromethylsulfanyl)phenyl]ethanone. InChIKey: PJZYCTROGSSATA-UHFFFAOYSA-N.
| Molecular formula | C9H8F2OS |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 1-[4-(difluoromethylsulfanyl)phenyl]ethanone |
| InChIKey | PJZYCTROGSSATA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)SC(F)F |
Computed by PubChem (NCBI)